![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
A Hero From a Thousand Paces | 20-Apr-2018 16:20 | - | |
|
Adam Milosz | 20-Apr-2018 16:20 | - | |
|
Adama Yalomba | 20-Apr-2018 16:20 | - | |
|
Aerolíneas Subterráneas | 20-Apr-2018 16:20 | - | |
|
Afghan Whigs | 20-Apr-2018 16:20 | - | |
|
Aija Kukule | 20-Apr-2018 16:20 | - | |
|
Aikamiehet | 20-Apr-2018 16:20 | - | |
|
Alois Huber | 20-Apr-2018 16:20 | - | |
|
Alpaca Ensemble | 20-Apr-2018 16:20 | - | |
|
Ann Christine, Four Cats, Jaakko Salon Orkesteri | 20-Apr-2018 16:20 | - | |
|
Another Reason | 20-Apr-2018 16:20 | - | |
|
Arrow Down Hill | 20-Apr-2018 16:20 | - | |
|
Arrow Lourette | 20-Apr-2018 16:20 | - | |
|
Atratus | 20-Apr-2018 16:20 | - | |
|
Aux Raus | 20-Apr-2018 16:20 | - | |
|
Baldrian | 20-Apr-2018 16:20 | - | |
|
Big Joe Turner & Roomful of Blues | 20-Apr-2018 16:20 | - | |
|
Binary Race | 20-Apr-2018 16:20 | - | |
|
Bird Show Band | 20-Apr-2018 16:20 | - | |
|
Black Swan⁄Shadow | 20-Apr-2018 16:20 | - | |
|
Blackwater Park | 20-Apr-2018 16:20 | - | |
|
Blackway | 20-Apr-2018 16:20 | - | |
|
Bluetile Lounge | 20-Apr-2018 16:20 | - | |
|
Bobby Hachey | 20-Apr-2018 16:20 | - | |
|
Brick & Lace | 20-Apr-2018 16:20 | - | |
|
Brother Crow | 20-Apr-2018 16:20 | - | |
|
Brown Recluse Sings | 20-Apr-2018 16:20 | - | |
|
Burman Flash | 20-Apr-2018 16:20 | - | |
|
C Photon | 20-Apr-2018 16:20 | - | |
|
Captain Duff | 20-Apr-2018 16:20 | - | |
|
Carl Barron | 20-Apr-2018 16:20 | - | |
|
Carnavalito | 20-Apr-2018 16:20 | - | |
|
Caveman Hughscore | 20-Apr-2018 16:20 | - | |
|
Chella H. | 20-Apr-2018 16:20 | - | |
|
Chromatix | 20-Apr-2018 16:20 | - | |
|
Cinderella Effect | 20-Apr-2018 16:20 | - | |
|
Cirrhosis | 20-Apr-2018 16:20 | - | |
|
Claude Gordon & His Orchestra | 20-Apr-2018 16:20 | - | |
|
Cletus Got Shot | 20-Apr-2018 16:20 | - | |
|
Clinton R. LeFort | 20-Apr-2018 16:20 | - | |
|
Cobra | 20-Apr-2018 16:20 | - | |
|
Coco Da Silva | 20-Apr-2018 16:20 | - | |
|
Corvus Corax | 20-Apr-2018 16:20 | - | |
|
Creole String Beans | 20-Apr-2018 16:20 | - | |
|
Cristal | 20-Apr-2018 16:20 | - | |
|
Curly's Revenge | 20-Apr-2018 16:20 | - | |
|
Cyrine Abdel Nour | 20-Apr-2018 16:20 | - | |
|
DJ Tr!p | 20-Apr-2018 16:20 | - | |
|
Daisycutter | 20-Apr-2018 16:20 | - | |
|
Dan Baird | 20-Apr-2018 16:20 | - | |
|
Danieto | 20-Apr-2018 16:20 | - | |
|
Dave Peabody | 20-Apr-2018 16:20 | - | |
|
David Holland ⁄ Barre Phillips | 20-Apr-2018 16:20 | - | |
|
Dazed | 20-Apr-2018 16:20 | - | |
|
Depp Jones | 20-Apr-2018 16:20 | - | |
|
Discovery | 20-Apr-2018 16:20 | - | |
|
Dj Seeq | 20-Apr-2018 16:20 | - | |
|
Doghead | 20-Apr-2018 16:20 | - | |
|
Doktor Loop | 20-Apr-2018 16:20 | - | |
|
Dom Mody | 20-Apr-2018 16:20 | - | |
|
Edu & Cramp | 20-Apr-2018 16:20 | - | |
|
Eltan Renaxy | 20-Apr-2018 16:20 | - | |
|
Eltro | 20-Apr-2018 16:20 | - | |
|
Empire-Builder | 20-Apr-2018 16:20 | - | |
|
English | 20-Apr-2018 16:20 | - | |
|
Epidemic | 20-Apr-2018 16:20 | - | |
|
Esteban Morgado Cuarteto | 20-Apr-2018 16:20 | - | |
|
Exit by Name | 20-Apr-2018 16:20 | - | |
|
Extra Hot DJ's | 20-Apr-2018 16:20 | - | |
|
Exx | 20-Apr-2018 16:20 | - | |
|
FDF | 20-Apr-2018 16:20 | - | |
|
Fall on Your Sword | 20-Apr-2018 16:20 | - | |
|
Feeding People | 20-Apr-2018 16:20 | - | |
|
Flutopia | 20-Apr-2018 16:20 | - | |
|
Foetus Art Terrorism | 20-Apr-2018 16:20 | - | |
|
For Stars | 20-Apr-2018 16:20 | - | |
|
Fritz Lichtenhahn | 20-Apr-2018 16:20 | - | |
|
Frontway | 20-Apr-2018 16:20 | - | |
|
Gawron Paris | 20-Apr-2018 16:20 | - | |
|
Ghost to Falco | 20-Apr-2018 16:20 | - | |
|
Gilbert | 20-Apr-2018 16:20 | - | |
|
Gilgamesj | 20-Apr-2018 16:20 | - | |
|
Goreweeg | 20-Apr-2018 16:20 | - | |
|
Gravity Willing | 20-Apr-2018 16:20 | - | |
|
Grupo Unamérica | 20-Apr-2018 16:20 | - | |
|
Gypsy & The Cat | 20-Apr-2018 16:20 | - | |
|
Hanky and Panky | 20-Apr-2018 16:20 | - | |
|
Harald Haugaard & Anders Mogensen | 20-Apr-2018 16:20 | - | |
|
Healing Place Music | 20-Apr-2018 16:20 | - | |
|
Heavy Stereo | 20-Apr-2018 16:20 | - | |
|
Heinz von Foerster | 20-Apr-2018 16:20 | - | |
|
Heldur Jõgioja | 20-Apr-2018 16:20 | - | |
|
Helsinki Poetry | 20-Apr-2018 16:20 | - | |
|
Honeymoon In Green | 20-Apr-2018 16:20 | - | |
|
I cosi | 20-Apr-2018 16:20 | - | |
|
IBOPA | 20-Apr-2018 16:20 | - | |
|
International Orange | 20-Apr-2018 16:20 | - | |
|
Interseed | 20-Apr-2018 16:20 | - | |
|
It Will Come | 20-Apr-2018 16:20 | - | |
|
JVOX | 20-Apr-2018 16:20 | - | |
|
Jacky Molard Acoustic Quartet | 20-Apr-2018 16:20 | - | |
|
Jewels Newton | 20-Apr-2018 16:20 | - | |
|
Jim Lauderdale with Donna the Buffalo | 20-Apr-2018 16:20 | - | |
|
Joe Craven Trio | 20-Apr-2018 16:20 | - | |
|
Joe Morris, William Parker & Gerald Cleaver | 20-Apr-2018 16:20 | - | |
|
Johan Svedberg & Hopslängt | 20-Apr-2018 16:20 | - | |
|
Jon Poole | 20-Apr-2018 16:20 | - | |
|
Jonas the Plugexpert | 20-Apr-2018 16:20 | - | |
|
Jonny Berliner | 20-Apr-2018 16:20 | - | |
|
Jormgrun | 20-Apr-2018 16:20 | - | |
|
Junkfood Junkies | 20-Apr-2018 16:20 | - | |
|
Järsumäe Virve ja Olavi Kõrre | 20-Apr-2018 16:20 | - | |
|
Jérôme hameau | 20-Apr-2018 16:20 | - | |
|
Karibean | 20-Apr-2018 16:20 | - | |
|
Kasar | 20-Apr-2018 16:20 | - | |
|
Kenny MacLean | 20-Apr-2018 16:20 | - | |
|
Kevin Denney | 20-Apr-2018 16:20 | - | |
|
Kevin M. Krebs | 20-Apr-2018 16:20 | - | |
|
Khosmaker | 20-Apr-2018 16:20 | - | |
|
KnifeLadder | 20-Apr-2018 16:20 | - | |
|
Konrad Bayer | 20-Apr-2018 16:20 | - | |
|
Kush Wonder | 20-Apr-2018 16:20 | - | |
|
L'Trimm | 20-Apr-2018 16:20 | - | |
|
La Gargote | 20-Apr-2018 16:20 | - | |
|
Lachenmayr, Waldvogel, Cremer | 20-Apr-2018 16:20 | - | |
|
Le Grande Boofont | 20-Apr-2018 16:20 | - | |
|
Lemmy | 20-Apr-2018 16:20 | - | |
|
Les forces du mal | 20-Apr-2018 16:20 | - | |
|
Liquid Crunch Tower | 20-Apr-2018 16:20 | - | |
|
Lord Vanger | 20-Apr-2018 16:20 | - | |
|
Los Cosmonautas Rusos | 20-Apr-2018 16:20 | - | |
|
Loscoe State Opera | 20-Apr-2018 16:20 | - | |
|
Lost Buddha | 20-Apr-2018 16:20 | - | |
|
Love De-Luxe | 20-Apr-2018 16:20 | - | |
|
Léonard Lasry | 20-Apr-2018 16:20 | - | |
|
Lützencraft | 20-Apr-2018 16:20 | - | |
|
M3 | 20-Apr-2018 16:20 | - | |
|
MVSEVM | 20-Apr-2018 16:20 | - | |
|
Makana | 20-Apr-2018 16:20 | - | |
|
Marc Neyen | 20-Apr-2018 16:20 | - | |
|
Marcelo Delacroix | 20-Apr-2018 16:20 | - | |
|
Marimba | 20-Apr-2018 16:20 | - | |
|
Mark Sullivan | 20-Apr-2018 16:20 | - | |
|
Martin Ljung | 20-Apr-2018 16:20 | - | |
|
Matt Steckler | 20-Apr-2018 16:20 | - | |
|
Mica Arisaka | 20-Apr-2018 16:20 | - | |
|
Michael Men Project | 20-Apr-2018 16:20 | - | |
|
Mika Vainio, Kouhei Matsunaga, Sean Booth | 20-Apr-2018 16:20 | - | |
|
Minnah Karlsson | 20-Apr-2018 16:20 | - | |
|
Mixtapes & Cellmates | 20-Apr-2018 16:20 | - | |
|
Monoshock | 20-Apr-2018 16:20 | - | |
|
Mummy Fortuna's Theatre Company | 20-Apr-2018 16:20 | - | |
|
Muriel bloch | 20-Apr-2018 16:20 | - | |
|
Murray Burns | 20-Apr-2018 16:20 | - | |
|
Mutual Friends | 20-Apr-2018 16:20 | - | |
|
My Last Fall | 20-Apr-2018 16:20 | - | |
|
Método Shintaro | 20-Apr-2018 16:20 | - | |
|
Nadir | 20-Apr-2018 16:20 | - | |
|
Nasty Niggas | 20-Apr-2018 16:20 | - | |
|
Necropsy | 20-Apr-2018 16:20 | - | |
|
Negative-A & Tymon | 20-Apr-2018 16:20 | - | |
|
Noize | 20-Apr-2018 16:20 | - | |
|
Nuclear Holoklaus | 20-Apr-2018 16:20 | - | |
|
Olivier Delevingne | 20-Apr-2018 16:20 | - | |
|
Onkel Hotte & Die beschissenen Sechs | 20-Apr-2018 16:20 | - | |
|
Orange Island | 20-Apr-2018 16:20 | - | |
|
Orbert Davis | 20-Apr-2018 16:20 | - | |
|
Paper Machete | 20-Apr-2018 16:20 | - | |
|
Parris Mitchell | 20-Apr-2018 16:20 | - | |
|
Pau Torres | 20-Apr-2018 16:20 | - | |
|
Pedro Migueis | 20-Apr-2018 16:20 | - | |
|
Pink Turds in Space | 20-Apr-2018 16:20 | - | |
|
Point Valid with Catherine Asaro | 20-Apr-2018 16:20 | - | |
|
Preed | 20-Apr-2018 16:20 | - | |
|
Prototypes | 20-Apr-2018 16:20 | - | |
|
Quest Studios | 20-Apr-2018 16:20 | - | |
|
R-18 | 20-Apr-2018 16:20 | - | |
|
Ranjit Dhaliwal | 20-Apr-2018 16:20 | - | |
|
Raving Loonatics | 20-Apr-2018 16:20 | - | |
|
Raw Jawz | 20-Apr-2018 16:20 | - | |
|
Recess | 20-Apr-2018 16:20 | - | |
|
Resynthesize | 20-Apr-2018 16:20 | - | |
|
Rhonda Merrick | 20-Apr-2018 16:20 | - | |
|
Ron Saltmarsh | 20-Apr-2018 16:20 | - | |
|
Rosemary Clooney & The Count Basie Orchestra | 20-Apr-2018 16:20 | - | |
|
Rusuden | 20-Apr-2018 16:20 | - | |
|
Sainkho Namchylak & Ned Rothenberg | 20-Apr-2018 16:20 | - | |
|
Santa Maria Gasolina em Teu Ventre | 20-Apr-2018 16:20 | - | |
|
Santa Sabina | 20-Apr-2018 16:20 | - | |
|
Sarah Jane Cion | 20-Apr-2018 16:20 | - | |
|
Satureye | 20-Apr-2018 16:20 | - | |
|
Savourna Stevenson, June Tabor & Danny Thompson | 20-Apr-2018 16:20 | - | |
|
Seden Gürel & Keremcem | 20-Apr-2018 16:20 | - | |
|
Sensation White | 20-Apr-2018 16:20 | - | |
|
Siamese | 20-Apr-2018 16:20 | - | |
|
Slava Tsukerman | 20-Apr-2018 16:20 | - | |
|
Smartbomb | 20-Apr-2018 16:20 | - | |
|
Soane | 20-Apr-2018 16:20 | - | |
|
Sonic Division | 20-Apr-2018 16:20 | - | |
|
Sonseed | 20-Apr-2018 16:20 | - | |
|
Spell 336 | 20-Apr-2018 16:20 | - | |
|
Spyweirdos and John Mourjopoulos with Floros Floridis | 20-Apr-2018 16:20 | - | |
|
Stephen Rippy, David Rippy & Kevin McMullan | 20-Apr-2018 16:20 | - | |
|
Stiff Miners | 20-Apr-2018 16:20 | - | |
|
Stradaperta | 20-Apr-2018 16:20 | - | |
|
Stéphane Blok | 20-Apr-2018 16:20 | - | |
|
Submania | 20-Apr-2018 16:20 | - | |
|
Swi.T | 20-Apr-2018 16:20 | - | |
|
THETHYRDAY | 20-Apr-2018 16:20 | - | |
|
Technikal Difficulties | 20-Apr-2018 16:20 | - | |
|
Techture | 20-Apr-2018 16:20 | - | |
|
Tender Objects | 20-Apr-2018 16:20 | - | |
|
The Beast Wrestling Foundation | 20-Apr-2018 16:20 | - | |
|
The Benka Boradovsky Bordello Band | 20-Apr-2018 16:20 | - | |
|
The End of the Cyberworms | 20-Apr-2018 16:20 | - | |
|
The G... | 20-Apr-2018 16:20 | - | |
|
The Modern Deep Left Quartet | 20-Apr-2018 16:20 | - | |
|
The Moirai | 20-Apr-2018 16:20 | - | |
|
The Offbeat Generator | 20-Apr-2018 16:20 | - | |
|
The Perrys | 20-Apr-2018 16:20 | - | |
|
The Postage Stamps | 20-Apr-2018 16:20 | - | |
|
The Tewlips | 20-Apr-2018 16:20 | - | |
|
Todo el largo verano | 20-Apr-2018 16:20 | - | |
|
Tom McGurk | 20-Apr-2018 16:20 | - | |
|
Toni Latenz | 20-Apr-2018 16:20 | - | |
|
Trai'D | 20-Apr-2018 16:20 | - | |
|
Tree of Snakes | 20-Apr-2018 16:20 | - | |
|
Valerie Nilon | 20-Apr-2018 16:20 | - | |
|
Vojta Kiďák Tomáško & Ríša Melichar | 20-Apr-2018 16:20 | - | |
|
Vordven | 20-Apr-2018 16:20 | - | |
|
Vénus 3 | 20-Apr-2018 16:20 | - | |
|
W&Whale | 20-Apr-2018 16:20 | - | |
|
We Smile | 20-Apr-2018 16:20 | - | |
|
Wendie Colter | 20-Apr-2018 16:20 | - | |
|
Within Blood | 20-Apr-2018 16:20 | - | |
|
YG Family | 20-Apr-2018 16:20 | - | |
|
Yussi & Django | 20-Apr-2018 16:20 | - | |
|
Zagrebački jazz kvartet | 20-Apr-2018 16:20 | - | |
|
Zeckzo | 20-Apr-2018 16:20 | - | |
|
Ziana Zain | 20-Apr-2018 16:20 | - | |
|
hurts | 20-Apr-2018 16:20 | - | |
|
lo | 20-Apr-2018 16:20 | - | |
|
pigeon mort | 20-Apr-2018 16:20 | - | |
|
Éric Poinçot | 20-Apr-2018 16:20 | - | |
|
Θανάσης Παπακωνσταντίνου & Μελίνα Κανά | 20-Apr-2018 16:20 | - | |
|
Κώστας Μάκρας & Γιώργος Μάκρας | 20-Apr-2018 16:20 | - | |
|
Инженер Феррис & Таня "Кровавая Баня" Beloved | 20-Apr-2018 16:20 | - | |
|
ジェットストリームオーケストラ | 20-Apr-2018 16:20 | - | |
|
工藤礼子 | 20-Apr-2018 16:20 | - | |
|
松前緒花(CV:伊藤かな恵) | 20-Apr-2018 16:20 | - | |